C31H38N4O3 — CID 4691013
2-(4-benzylpiperidin-1-yl)-5-[(2,6-dimethylphenyl)carbamoylamino]-N-(2-methoxyethyl)benzamide (PubChem CID 4691013) has the molecular formula C31H38N4O3 and a molecular weight of 514.67 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-5-[(2,6-dimethylphenyl)carbamoylamino]-N-(2-methoxyethyl)benzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-5-[(2,6-dimethylphenyl)carbamoylamino]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 4691013 |
| Molecular Formula | C31H38N4O3 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-5-[(2,6-dimethylphenyl)carbamoylamino]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1cc(NC(=O)Nc2c(C)cccc2C)ccc1N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C31H38N4O3/c1-22-8-7-9-23(2)29(22)34-31(37)33-26-12-13-28(27(21-26)30(36)32-16-19-38-3)35-17-14-25(15-18-35)20-24-10-5-4-6-11-24/h4-13,21,25H,14-20H2,1-3H3,(H,32,36)(H2,33,34,37) |
| InChIKey | MQHLBLNGQXIKCC-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|