C34H43N5O3 — CID 1064282
2-(4-benzylpiperidin-1-yl)-5-[(3-ethylphenyl)carbamoylamino]-N-(2-morpholin-4-ylethyl)benzamide (PubChem CID 1064282) has the molecular formula C34H43N5O3 and a molecular weight of 569.75 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-5-[(3-ethylphenyl)carbamoylamino]-N-(2-morpholin-4-ylethyl)benzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-5-[(3-ethylphenyl)carbamoylamino]-N-(2-morpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 1064282 |
| Molecular Formula | C34H43N5O3 |
| Molecular Weight | 569.75 g/mol |
| Exact Mass | 569.34 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-5-[(3-ethylphenyl)carbamoylamino]-N-(2-morpholin-4-ylethyl)benzamide |
| SMILES | CCc1cccc(NC(=O)Nc2ccc(N3CCC(Cc4ccccc4)CC3)c(C(=O)NCCN3CCOCC3)c2)c1 |
| InChI | InChI=1S/C34H43N5O3/c1-2-26-9-6-10-29(24-26)36-34(41)37-30-11-12-32(31(25-30)33(40)35-15-18-38-19-21-42-22-20-38)39-16-13-28(14-17-39)23-27-7-4-3-5-8-27/h3-12,24-25,28H,2,13-23H2,1H3,(H,35,40)(H2,36,37,41) |
| InChIKey | BTAXRKVSNUMCPB-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.75 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|