C33H39FN4O3 — CID 3890026
2-(4-benzylpiperidin-1-yl)-5-[(4-fluorobenzoyl)amino]-N-(3-morpholin-4-ylpropyl)benzamide (PubChem CID 3890026) has the molecular formula C33H39FN4O3 and a molecular weight of 558.70 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-5-[(4-fluorobenzoyl)amino]-N-(3-morpholin-4-ylpropyl)benzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-5-[(4-fluorobenzoyl)amino]-N-(3-morpholin-4-ylpropyl)benzamide |
|---|---|
| PubChem CID | 3890026 |
| Molecular Formula | C33H39FN4O3 |
| Molecular Weight | 558.70 g/mol |
| Exact Mass | 558.30 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-5-[(4-fluorobenzoyl)amino]-N-(3-morpholin-4-ylpropyl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCC(Cc3ccccc3)CC2)c(C(=O)NCCCN2CCOCC2)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C33H39FN4O3/c34-28-9-7-27(8-10-28)32(39)36-29-11-12-31(38-17-13-26(14-18-38)23-25-5-2-1-3-6-25)30(24-29)33(40)35-15-4-16-37-19-21-41-22-20-37/h1-3,5-12,24,26H,4,13-23H2,(H,35,40)(H,36,39) |
| InChIKey | AMAQEAOJAGVOLM-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.70 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|