C27H35ClN4O3 — CID 42751462
5-[(3-chlorobenzoyl)amino]-2-(4-methylpiperidin-1-yl)-N-(3-morpholin-4-ylpropyl)benzamide (PubChem CID 42751462) has the molecular formula C27H35ClN4O3 and a molecular weight of 499.06 g/mol. Its IUPAC name is 5-[(3-chlorobenzoyl)amino]-2-(4-methylpiperidin-1-yl)-N-(3-morpholin-4-ylpropyl)benzamide.
| Compound Name | 5-[(3-chlorobenzoyl)amino]-2-(4-methylpiperidin-1-yl)-N-(3-morpholin-4-ylpropyl)benzamide |
|---|---|
| PubChem CID | 42751462 |
| Molecular Formula | C27H35ClN4O3 |
| Molecular Weight | 499.06 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 5-[(3-chlorobenzoyl)amino]-2-(4-methylpiperidin-1-yl)-N-(3-morpholin-4-ylpropyl)benzamide |
| SMILES | CC1CCN(c2ccc(NC(=O)c3cccc(Cl)c3)cc2C(=O)NCCCN2CCOCC2)CC1 |
| InChI | InChI=1S/C27H35ClN4O3/c1-20-8-12-32(13-9-20)25-7-6-23(30-26(33)21-4-2-5-22(28)18-21)19-24(25)27(34)29-10-3-11-31-14-16-35-17-15-31/h2,4-7,18-20H,3,8-17H2,1H3,(H,29,34)(H,30,33) |
| InChIKey | ONYRZPQZZJOFSN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.06 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|