C29H38N4O3 — CID 5234942
2-(4-methylpiperidin-1-yl)-N-(3-morpholin-4-ylpropyl)-5-(3-phenylprop-2-enoylamino)benzamide (PubChem CID 5234942) has the molecular formula C29H38N4O3 and a molecular weight of 490.65 g/mol. Its IUPAC name is 2-(4-methylpiperidin-1-yl)-N-(3-morpholin-4-ylpropyl)-5-(3-phenylprop-2-enoylamino)benzamide.
| Compound Name | 2-(4-methylpiperidin-1-yl)-N-(3-morpholin-4-ylpropyl)-5-(3-phenylprop-2-enoylamino)benzamide |
|---|---|
| PubChem CID | 5234942 |
| Molecular Formula | C29H38N4O3 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | 2-(4-methylpiperidin-1-yl)-N-(3-morpholin-4-ylpropyl)-5-(3-phenylprop-2-enoylamino)benzamide |
| SMILES | CC1CCN(c2ccc(NC(=O)C=Cc3ccccc3)cc2C(=O)NCCCN2CCOCC2)CC1 |
| InChI | InChI=1S/C29H38N4O3/c1-23-12-16-33(17-13-23)27-10-9-25(31-28(34)11-8-24-6-3-2-4-7-24)22-26(27)29(35)30-14-5-15-32-18-20-36-21-19-32/h2-4,6-11,22-23H,5,12-21H2,1H3,(H,30,35)(H,31,34) |
| InChIKey | WIOXUIHXRIFWSH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|