C32H39N5O4 — CID 42752910
5-benzamido-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(3-morpholin-4-ylpropyl)benzamide (PubChem CID 42752910) has the molecular formula C32H39N5O4 and a molecular weight of 557.70 g/mol. Its IUPAC name is 5-benzamido-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(3-morpholin-4-ylpropyl)benzamide.
| Compound Name | 5-benzamido-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(3-morpholin-4-ylpropyl)benzamide |
|---|---|
| PubChem CID | 42752910 |
| Molecular Formula | C32H39N5O4 |
| Molecular Weight | 557.70 g/mol |
| Exact Mass | 557.30 |
| IUPAC Name | 5-benzamido-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(3-morpholin-4-ylpropyl)benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)c3ccccc3)cc2C(=O)NCCCN2CCOCC2)CC1 |
| InChI | InChI=1S/C32H39N5O4/c1-40-30-11-6-5-10-29(30)37-18-16-36(17-19-37)28-13-12-26(34-31(38)25-8-3-2-4-9-25)24-27(28)32(39)33-14-7-15-35-20-22-41-23-21-35/h2-6,8-13,24H,7,14-23H2,1H3,(H,33,39)(H,34,38) |
| InChIKey | ZWQCNJHXCLTFGW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.70 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|