C35H39N5O4 — CID 4003160
N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(2-morpholin-4-ylethylcarbamoyl)phenyl]naphthalene-1-carboxamide (PubChem CID 4003160) has the molecular formula C35H39N5O4 and a molecular weight of 593.73 g/mol. Its IUPAC name is N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(2-morpholin-4-ylethylcarbamoyl)phenyl]naphthalene-1-carboxamide.
| Compound Name | N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(2-morpholin-4-ylethylcarbamoyl)phenyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 4003160 |
| Molecular Formula | C35H39N5O4 |
| Molecular Weight | 593.73 g/mol |
| Exact Mass | 593.30 |
| IUPAC Name | N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(2-morpholin-4-ylethylcarbamoyl)phenyl]naphthalene-1-carboxamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)c3cccc4ccccc34)cc2C(=O)NCCN2CCOCC2)CC1 |
| InChI | InChI=1S/C35H39N5O4/c1-43-33-12-5-4-11-32(33)40-19-17-39(18-20-40)31-14-13-27(25-30(31)34(41)36-15-16-38-21-23-44-24-22-38)37-35(42)29-10-6-8-26-7-2-3-9-28(26)29/h2-14,25H,15-24H2,1H3,(H,36,41)(H,37,42) |
| InChIKey | SKLCNOPYPJPJBI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.73 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|