C25H33N5O4 — CID 1064254
5-[(3-methoxyphenyl)carbamoylamino]-N-(2-morpholin-4-ylethyl)-2-pyrrolidin-1-ylbenzamide (PubChem CID 1064254) has the molecular formula C25H33N5O4 and a molecular weight of 467.57 g/mol. Its IUPAC name is 5-[(3-methoxyphenyl)carbamoylamino]-N-(2-morpholin-4-ylethyl)-2-pyrrolidin-1-ylbenzamide.
| Compound Name | 5-[(3-methoxyphenyl)carbamoylamino]-N-(2-morpholin-4-ylethyl)-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 1064254 |
| Molecular Formula | C25H33N5O4 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | 5-[(3-methoxyphenyl)carbamoylamino]-N-(2-morpholin-4-ylethyl)-2-pyrrolidin-1-ylbenzamide |
| SMILES | COc1cccc(NC(=O)Nc2ccc(N3CCCC3)c(C(=O)NCCN3CCOCC3)c2)c1 |
| InChI | InChI=1S/C25H33N5O4/c1-33-21-6-4-5-19(17-21)27-25(32)28-20-7-8-23(30-10-2-3-11-30)22(18-20)24(31)26-9-12-29-13-15-34-16-14-29/h4-8,17-18H,2-3,9-16H2,1H3,(H,26,31)(H2,27,28,32) |
| InChIKey | MQXVURLWOVNAFQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|