C24H33N5O4 — CID 3907319
2-(dimethylamino)-5-[(3-methoxyphenyl)carbamoylamino]-N-(3-morpholin-4-ylpropyl)benzamide (PubChem CID 3907319) has the molecular formula C24H33N5O4 and a molecular weight of 455.56 g/mol. Its IUPAC name is 2-(dimethylamino)-5-[(3-methoxyphenyl)carbamoylamino]-N-(3-morpholin-4-ylpropyl)benzamide.
| Compound Name | 2-(dimethylamino)-5-[(3-methoxyphenyl)carbamoylamino]-N-(3-morpholin-4-ylpropyl)benzamide |
|---|---|
| PubChem CID | 3907319 |
| Molecular Formula | C24H33N5O4 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | 2-(dimethylamino)-5-[(3-methoxyphenyl)carbamoylamino]-N-(3-morpholin-4-ylpropyl)benzamide |
| SMILES | COc1cccc(NC(=O)Nc2ccc(N(C)C)c(C(=O)NCCCN3CCOCC3)c2)c1 |
| InChI | InChI=1S/C24H33N5O4/c1-28(2)22-9-8-19(27-24(31)26-18-6-4-7-20(16-18)32-3)17-21(22)23(30)25-10-5-11-29-12-14-33-15-13-29/h4,6-9,16-17H,5,10-15H2,1-3H3,(H,25,30)(H2,26,27,31) |
| InChIKey | OMVBAIJBXYMKFI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|