C22H28BrN5O3 — CID 42747855
5-[(4-bromophenyl)carbamoylamino]-2-(dimethylamino)-N-(2-morpholin-4-ylethyl)benzamide (PubChem CID 42747855) has the molecular formula C22H28BrN5O3 and a molecular weight of 490.40 g/mol. Its IUPAC name is 5-[(4-bromophenyl)carbamoylamino]-2-(dimethylamino)-N-(2-morpholin-4-ylethyl)benzamide.
| Compound Name | 5-[(4-bromophenyl)carbamoylamino]-2-(dimethylamino)-N-(2-morpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 42747855 |
| Molecular Formula | C22H28BrN5O3 |
| Molecular Weight | 490.40 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 5-[(4-bromophenyl)carbamoylamino]-2-(dimethylamino)-N-(2-morpholin-4-ylethyl)benzamide |
| SMILES | CN(C)c1ccc(NC(=O)Nc2ccc(Br)cc2)cc1C(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C22H28BrN5O3/c1-27(2)20-8-7-18(26-22(30)25-17-5-3-16(23)4-6-17)15-19(20)21(29)24-9-10-28-11-13-31-14-12-28/h3-8,15H,9-14H2,1-2H3,(H,24,29)(H2,25,26,30) |
| InChIKey | YGYRMFQJWLNUQD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|