C24H33N5O5 — CID 4265313
5-[(3,5-dimethoxyphenyl)carbamoylamino]-2-(dimethylamino)-N-(2-morpholin-4-ylethyl)benzamide (PubChem CID 4265313) has the molecular formula C24H33N5O5 and a molecular weight of 471.56 g/mol. Its IUPAC name is 5-[(3,5-dimethoxyphenyl)carbamoylamino]-2-(dimethylamino)-N-(2-morpholin-4-ylethyl)benzamide.
| Compound Name | 5-[(3,5-dimethoxyphenyl)carbamoylamino]-2-(dimethylamino)-N-(2-morpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 4265313 |
| Molecular Formula | C24H33N5O5 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | 5-[(3,5-dimethoxyphenyl)carbamoylamino]-2-(dimethylamino)-N-(2-morpholin-4-ylethyl)benzamide |
| SMILES | COc1cc(NC(=O)Nc2ccc(N(C)C)c(C(=O)NCCN3CCOCC3)c2)cc(OC)c1 |
| InChI | InChI=1S/C24H33N5O5/c1-28(2)22-6-5-17(15-21(22)23(30)25-7-8-29-9-11-34-12-10-29)26-24(31)27-18-13-19(32-3)16-20(14-18)33-4/h5-6,13-16H,7-12H2,1-4H3,(H,25,30)(H2,26,27,31) |
| InChIKey | FJTZBDHEDQXSEC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 104.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|