C24H40N4O3 — CID 42747432
2-(dimethylamino)-N-(2-morpholin-4-ylethyl)-5-(3,5,5-trimethylhexanoylamino)benzamide (PubChem CID 42747432) has the molecular formula C24H40N4O3 and a molecular weight of 432.61 g/mol. Its IUPAC name is 2-(dimethylamino)-N-(2-morpholin-4-ylethyl)-5-(3,5,5-trimethylhexanoylamino)benzamide.
| Compound Name | 2-(dimethylamino)-N-(2-morpholin-4-ylethyl)-5-(3,5,5-trimethylhexanoylamino)benzamide |
|---|---|
| PubChem CID | 42747432 |
| Molecular Formula | C24H40N4O3 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | 2-(dimethylamino)-N-(2-morpholin-4-ylethyl)-5-(3,5,5-trimethylhexanoylamino)benzamide |
| SMILES | CC(CC(=O)Nc1ccc(N(C)C)c(C(=O)NCCN2CCOCC2)c1)CC(C)(C)C |
| InChI | InChI=1S/C24H40N4O3/c1-18(17-24(2,3)4)15-22(29)26-19-7-8-21(27(5)6)20(16-19)23(30)25-9-10-28-11-13-31-14-12-28/h7-8,16,18H,9-15,17H2,1-6H3,(H,25,30)(H,26,29) |
| InChIKey | XHALOZNJHFPCTQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|