C23H28F3N5O3 — CID 42747851
2-(dimethylamino)-N-(2-morpholin-4-ylethyl)-5-[[2-(trifluoromethyl)phenyl]carbamoylamino]benzamide (PubChem CID 42747851) has the molecular formula C23H28F3N5O3 and a molecular weight of 479.50 g/mol. Its IUPAC name is 2-(dimethylamino)-N-(2-morpholin-4-ylethyl)-5-[[2-(trifluoromethyl)phenyl]carbamoylamino]benzamide.
| Compound Name | 2-(dimethylamino)-N-(2-morpholin-4-ylethyl)-5-[[2-(trifluoromethyl)phenyl]carbamoylamino]benzamide |
|---|---|
| PubChem CID | 42747851 |
| Molecular Formula | C23H28F3N5O3 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | 2-(dimethylamino)-N-(2-morpholin-4-ylethyl)-5-[[2-(trifluoromethyl)phenyl]carbamoylamino]benzamide |
| SMILES | CN(C)c1ccc(NC(=O)Nc2ccccc2C(F)(F)F)cc1C(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C23H28F3N5O3/c1-30(2)20-8-7-16(15-17(20)21(32)27-9-10-31-11-13-34-14-12-31)28-22(33)29-19-6-4-3-5-18(19)23(24,25)26/h3-8,15H,9-14H2,1-2H3,(H,27,32)(H2,28,29,33) |
| InChIKey | WANNMJMBCRFEGM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|