C27H44N4O3 — CID 42751400
N-(3-morpholin-4-ylpropyl)-2-pyrrolidin-1-yl-5-(3,5,5-trimethylhexanoylamino)benzamide (PubChem CID 42751400) has the molecular formula C27H44N4O3 and a molecular weight of 472.67 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-2-pyrrolidin-1-yl-5-(3,5,5-trimethylhexanoylamino)benzamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)-2-pyrrolidin-1-yl-5-(3,5,5-trimethylhexanoylamino)benzamide |
|---|---|
| PubChem CID | 42751400 |
| Molecular Formula | C27H44N4O3 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.34 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-2-pyrrolidin-1-yl-5-(3,5,5-trimethylhexanoylamino)benzamide |
| SMILES | CC(CC(=O)Nc1ccc(N2CCCC2)c(C(=O)NCCCN2CCOCC2)c1)CC(C)(C)C |
| InChI | InChI=1S/C27H44N4O3/c1-21(20-27(2,3)4)18-25(32)29-22-8-9-24(31-12-5-6-13-31)23(19-22)26(33)28-10-7-11-30-14-16-34-17-15-30/h8-9,19,21H,5-7,10-18,20H2,1-4H3,(H,28,33)(H,29,32) |
| InChIKey | ZNIWECGMIFZWLD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|