C26H34N4O4 — CID 42751409
5-[(3-methoxybenzoyl)amino]-N-(3-morpholin-4-ylpropyl)-2-pyrrolidin-1-ylbenzamide (PubChem CID 42751409) has the molecular formula C26H34N4O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is 5-[(3-methoxybenzoyl)amino]-N-(3-morpholin-4-ylpropyl)-2-pyrrolidin-1-ylbenzamide.
| Compound Name | 5-[(3-methoxybenzoyl)amino]-N-(3-morpholin-4-ylpropyl)-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 42751409 |
| Molecular Formula | C26H34N4O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 5-[(3-methoxybenzoyl)amino]-N-(3-morpholin-4-ylpropyl)-2-pyrrolidin-1-ylbenzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc(N3CCCC3)c(C(=O)NCCCN3CCOCC3)c2)c1 |
| InChI | InChI=1S/C26H34N4O4/c1-33-22-7-4-6-20(18-22)25(31)28-21-8-9-24(30-12-2-3-13-30)23(19-21)26(32)27-10-5-11-29-14-16-34-17-15-29/h4,6-9,18-19H,2-3,5,10-17H2,1H3,(H,27,32)(H,28,31) |
| InChIKey | YTAHAPXGIBVMLN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|