C35H33N5O3 — CID 1054189
N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(pyridin-3-ylmethylcarbamoyl)phenyl]naphthalene-1-carboxamide (PubChem CID 1054189) has the molecular formula C35H33N5O3 and a molecular weight of 571.68 g/mol. Its IUPAC name is N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(pyridin-3-ylmethylcarbamoyl)phenyl]naphthalene-1-carboxamide.
| Compound Name | N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(pyridin-3-ylmethylcarbamoyl)phenyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 1054189 |
| Molecular Formula | C35H33N5O3 |
| Molecular Weight | 571.68 g/mol |
| Exact Mass | 571.26 |
| IUPAC Name | N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(pyridin-3-ylmethylcarbamoyl)phenyl]naphthalene-1-carboxamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)c3cccc4ccccc34)cc2C(=O)NCc2cccnc2)CC1 |
| InChI | InChI=1S/C35H33N5O3/c1-43-33-14-5-4-13-32(33)40-20-18-39(19-21-40)31-16-15-27(22-30(31)34(41)37-24-25-8-7-17-36-23-25)38-35(42)29-12-6-10-26-9-2-3-11-28(26)29/h2-17,22-23H,18-21,24H2,1H3,(H,37,41)(H,38,42) |
| InChIKey | FYGGNCKLSLOWGO-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.68 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|