C33H35N5O5 — CID 1054188
5-[(3,5-dimethoxybenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 1054188) has the molecular formula C33H35N5O5 and a molecular weight of 581.67 g/mol. Its IUPAC name is 5-[(3,5-dimethoxybenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 5-[(3,5-dimethoxybenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 1054188 |
| Molecular Formula | C33H35N5O5 |
| Molecular Weight | 581.67 g/mol |
| Exact Mass | 581.26 |
| IUPAC Name | 5-[(3,5-dimethoxybenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2ccc(N3CCN(c4ccccc4OC)CC3)c(C(=O)NCc3cccnc3)c2)c1 |
| InChI | InChI=1S/C33H35N5O5/c1-41-26-17-24(18-27(20-26)42-2)32(39)36-25-10-11-29(28(19-25)33(40)35-22-23-7-6-12-34-21-23)37-13-15-38(16-14-37)30-8-4-5-9-31(30)43-3/h4-12,17-21H,13-16,22H2,1-3H3,(H,35,40)(H,36,39) |
| InChIKey | DXFWIWMDXURAGL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.67 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|