C31H30FN5O3 — CID 42762459
5-[(4-fluorobenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 42762459) has the molecular formula C31H30FN5O3 and a molecular weight of 539.61 g/mol. Its IUPAC name is 5-[(4-fluorobenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 5-[(4-fluorobenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 42762459 |
| Molecular Formula | C31H30FN5O3 |
| Molecular Weight | 539.61 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | 5-[(4-fluorobenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)c3ccc(F)cc3)cc2C(=O)NCc2cccnc2)CC1 |
| InChI | InChI=1S/C31H30FN5O3/c1-40-29-7-3-2-6-28(29)37-17-15-36(16-18-37)27-13-12-25(35-30(38)23-8-10-24(32)11-9-23)19-26(27)31(39)34-21-22-5-4-14-33-20-22/h2-14,19-20H,15-18,21H2,1H3,(H,34,39)(H,35,38) |
| InChIKey | VWBGKLIXYFUPRI-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.61 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|