C35H39N5O3 — CID 3450416
5-[(4-tert-butylbenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 3450416) has the molecular formula C35H39N5O3 and a molecular weight of 577.73 g/mol. Its IUPAC name is 5-[(4-tert-butylbenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 5-[(4-tert-butylbenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 3450416 |
| Molecular Formula | C35H39N5O3 |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.31 |
| IUPAC Name | 5-[(4-tert-butylbenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)c3ccc(C(C)(C)C)cc3)cc2C(=O)NCc2cccnc2)CC1 |
| InChI | InChI=1S/C35H39N5O3/c1-35(2,3)27-13-11-26(12-14-27)33(41)38-28-15-16-30(29(22-28)34(42)37-24-25-8-7-17-36-23-25)39-18-20-40(21-19-39)31-9-5-6-10-32(31)43-4/h5-17,22-23H,18-21,24H2,1-4H3,(H,37,42)(H,38,41) |
| InChIKey | JLAWXYJXGVJNHU-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|