C32H38N4O6 — CID 3929795
5-[(3,5-dimethoxybenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 3929795) has the molecular formula C32H38N4O6 and a molecular weight of 574.68 g/mol. Its IUPAC name is 5-[(3,5-dimethoxybenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 5-[(3,5-dimethoxybenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 3929795 |
| Molecular Formula | C32H38N4O6 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | 5-[(3,5-dimethoxybenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2ccc(N3CCN(c4ccccc4OC)CC3)c(C(=O)NCC3CCCO3)c2)c1 |
| InChI | InChI=1S/C32H38N4O6/c1-39-25-17-22(18-26(20-25)40-2)31(37)34-23-10-11-28(27(19-23)32(38)33-21-24-7-6-16-42-24)35-12-14-36(15-13-35)29-8-4-5-9-30(29)41-3/h4-5,8-11,17-20,24H,6-7,12-16,21H2,1-3H3,(H,33,38)(H,34,37) |
| InChIKey | FBRROAKEKYOHKU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 101.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|