C29H38N4O4 — CID 1063748
5-(cyclopentanecarbonylamino)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-[[(2R)-oxolan-2-yl]methyl]benzamide (PubChem CID 1063748) has the molecular formula C29H38N4O4 and a molecular weight of 506.65 g/mol. Its IUPAC name is 5-(cyclopentanecarbonylamino)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-[[(2R)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 5-(cyclopentanecarbonylamino)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-[[(2R)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 1063748 |
| Molecular Formula | C29H38N4O4 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | 5-(cyclopentanecarbonylamino)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-[[(2R)-oxolan-2-yl]methyl]benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)C3CCCC3)cc2C(=O)NC[C@H]2CCCO2)CC1 |
| InChI | InChI=1S/C29H38N4O4/c1-36-27-11-5-4-10-26(27)33-16-14-32(15-17-33)25-13-12-22(31-28(34)21-7-2-3-8-21)19-24(25)29(35)30-20-23-9-6-18-37-23/h4-5,10-13,19,21,23H,2-3,6-9,14-18,20H2,1H3,(H,30,35)(H,31,34)/t23-/m1/s1 |
| InChIKey | CCMDGIHJEAHCPX-HSZRJFAPSA-N |
| XLogP | 4.06 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|