C30H41N5O4 — CID 1065756
5-(cyclohexylcarbamoylamino)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-[[(2R)-oxolan-2-yl]methyl]benzamide (PubChem CID 1065756) has the molecular formula C30H41N5O4 and a molecular weight of 535.69 g/mol. Its IUPAC name is 5-(cyclohexylcarbamoylamino)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-[[(2R)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 5-(cyclohexylcarbamoylamino)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-[[(2R)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 1065756 |
| Molecular Formula | C30H41N5O4 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.32 |
| IUPAC Name | 5-(cyclohexylcarbamoylamino)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-[[(2R)-oxolan-2-yl]methyl]benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)NC3CCCCC3)cc2C(=O)NC[C@H]2CCCO2)CC1 |
| InChI | InChI=1S/C30H41N5O4/c1-38-28-12-6-5-11-27(28)35-17-15-34(16-18-35)26-14-13-23(33-30(37)32-22-8-3-2-4-9-22)20-25(26)29(36)31-21-24-10-7-19-39-24/h5-6,11-14,20,22,24H,2-4,7-10,15-19,21H2,1H3,(H,31,36)(H2,32,33,37)/t24-/m1/s1 |
| InChIKey | JLSXHZCMAWJSFR-XMMPIXPASA-N |
| XLogP | 4.38 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|