C32H36N4O4 — CID 42756148
2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)-5-[[(E)-3-phenylprop-2-enoyl]amino]benzamide (PubChem CID 42756148) has the molecular formula C32H36N4O4 and a molecular weight of 540.66 g/mol. Its IUPAC name is 2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)-5-[[(E)-3-phenylprop-2-enoyl]amino]benzamide.
| Compound Name | 2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)-5-[[(E)-3-phenylprop-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 42756148 |
| Molecular Formula | C32H36N4O4 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | 2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)-5-[[(E)-3-phenylprop-2-enoyl]amino]benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)/C=C/c3ccccc3)cc2C(=O)NCC2CCCO2)CC1 |
| InChI | InChI=1S/C32H36N4O4/c1-39-30-12-6-5-11-29(30)36-19-17-35(18-20-36)28-15-14-25(34-31(37)16-13-24-8-3-2-4-9-24)22-27(28)32(38)33-23-26-10-7-21-40-26/h2-6,8-9,11-16,22,26H,7,10,17-21,23H2,1H3,(H,33,38)(H,34,37)/b16-13+ |
| InChIKey | GTYAJHCDQKVGNK-DTQAZKPQSA-N |
| XLogP | 4.58 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|