C16H22N2O2 — CID 2319063
(E)-N-(3-morpholin-4-ylpropyl)-3-phenylprop-2-enamide (PubChem CID 2319063) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is (E)-N-(3-morpholin-4-ylpropyl)-3-phenylprop-2-enamide.
| Compound Name | (E)-N-(3-morpholin-4-ylpropyl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 2319063 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | (E)-N-(3-morpholin-4-ylpropyl)-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C16H22N2O2/c19-16(8-7-15-5-2-1-3-6-15)17-9-4-10-18-11-13-20-14-12-18/h1-3,5-8H,4,9-14H2,(H,17,19)/b8-7+ |
| InChIKey | SGVWIFLBJXFGBC-BQYQJAHWSA-N |
| XLogP | 1.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|