C28H34Cl2N4O2 — CID 3586028
3-(3-chlorophenyl)-N-[3-[4-[3-[3-(3-chlorophenyl)prop-2-enoylamino]propyl]piperazin-1-yl]propyl]prop-2-enamide (PubChem CID 3586028) has the molecular formula C28H34Cl2N4O2 and a molecular weight of 529.51 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N-[3-[4-[3-[3-(3-chlorophenyl)prop-2-enoylamino]propyl]piperazin-1-yl]propyl]prop-2-enamide.
| Compound Name | 3-(3-chlorophenyl)-N-[3-[4-[3-[3-(3-chlorophenyl)prop-2-enoylamino]propyl]piperazin-1-yl]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 3586028 |
| Molecular Formula | C28H34Cl2N4O2 |
| Molecular Weight | 529.51 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | 3-(3-chlorophenyl)-N-[3-[4-[3-[3-(3-chlorophenyl)prop-2-enoylamino]propyl]piperazin-1-yl]propyl]prop-2-enamide |
| SMILES | O=C(C=Cc1cccc(Cl)c1)NCCCN1CCN(CCCNC(=O)C=Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C28H34Cl2N4O2/c29-25-7-1-5-23(21-25)9-11-27(35)31-13-3-15-33-17-19-34(20-18-33)16-4-14-32-28(36)12-10-24-6-2-8-26(30)22-24/h1-2,5-12,21-22H,3-4,13-20H2,(H,31,35)(H,32,36) |
| InChIKey | GQAHUFRNRRKBOY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|