C16H22ClN3O — CID 43443260
(E)-3-(4-chlorophenyl)-N-(3-piperazin-1-ylpropyl)prop-2-enamide (PubChem CID 43443260) has the molecular formula C16H22ClN3O and a molecular weight of 307.82 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-(3-piperazin-1-ylpropyl)prop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-(3-piperazin-1-ylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 43443260 |
| Molecular Formula | C16H22ClN3O |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-(3-piperazin-1-ylpropyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)NCCCN1CCNCC1 |
| InChI | InChI=1S/C16H22ClN3O/c17-15-5-2-14(3-6-15)4-7-16(21)19-8-1-11-20-12-9-18-10-13-20/h2-7,18H,1,8-13H2,(H,19,21)/b7-4+ |
| InChIKey | MFGIBGXZHYOLAE-QPJJXVBHSA-N |
| XLogP | 1.76 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|