C28H34N6O6 — CID 6075459
(E)-3-(4-nitrophenyl)-N-[3-[4-[3-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]propyl]piperazin-1-yl]propyl]prop-2-enamide (PubChem CID 6075459) has the molecular formula C28H34N6O6 and a molecular weight of 550.62 g/mol. Its IUPAC name is (E)-3-(4-nitrophenyl)-N-[3-[4-[3-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]propyl]piperazin-1-yl]propyl]prop-2-enamide.
| Compound Name | (E)-3-(4-nitrophenyl)-N-[3-[4-[3-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]propyl]piperazin-1-yl]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 6075459 |
| Molecular Formula | C28H34N6O6 |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.25 |
| IUPAC Name | (E)-3-(4-nitrophenyl)-N-[3-[4-[3-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]propyl]piperazin-1-yl]propyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)NCCCN1CCN(CCCNC(=O)/C=C/c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C28H34N6O6/c35-27(13-7-23-3-9-25(10-4-23)33(37)38)29-15-1-17-31-19-21-32(22-20-31)18-2-16-30-28(36)14-8-24-5-11-26(12-6-24)34(39)40/h3-14H,1-2,15-22H2,(H,29,35)(H,30,36)/b13-7+,14-8+ |
| InChIKey | HCCRGZLGNJIVNR-FNCQTZNRSA-N |
| XLogP | 2.86 |
| TPSA | 150.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|