C18H26ClN3O — CID 110440061
(E)-3-(4-chlorophenyl)-N-[3-(4-ethylpiperazin-1-yl)propyl]prop-2-enamide (PubChem CID 110440061) has the molecular formula C18H26ClN3O and a molecular weight of 335.88 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-[3-(4-ethylpiperazin-1-yl)propyl]prop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-[3-(4-ethylpiperazin-1-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 110440061 |
| Molecular Formula | C18H26ClN3O |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-[3-(4-ethylpiperazin-1-yl)propyl]prop-2-enamide |
| SMILES | CCN1CCN(CCCNC(=O)/C=C/c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C18H26ClN3O/c1-2-21-12-14-22(15-13-21)11-3-10-20-18(23)9-6-16-4-7-17(19)8-5-16/h4-9H,2-3,10-15H2,1H3,(H,20,23)/b9-6+ |
| InChIKey | NTTZBSGHZOWVDP-RMKNXTFCSA-N |
| XLogP | 2.50 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|