C27H30Cl3N3O2 — CID 44529356
(E)-3-(4-chlorophenyl)-N-[5-[4-[3-(3,4-dichlorophenyl)prop-2-enoyl]piperazin-1-yl]pentyl]prop-2-enamide (PubChem CID 44529356) has the molecular formula C27H30Cl3N3O2 and a molecular weight of 534.92 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-[5-[4-[3-(3,4-dichlorophenyl)prop-2-enoyl]piperazin-1-yl]pentyl]prop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-[5-[4-[3-(3,4-dichlorophenyl)prop-2-enoyl]piperazin-1-yl]pentyl]prop-2-enamide |
|---|---|
| PubChem CID | 44529356 |
| Molecular Formula | C27H30Cl3N3O2 |
| Molecular Weight | 534.92 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-[5-[4-[3-(3,4-dichlorophenyl)prop-2-enoyl]piperazin-1-yl]pentyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)NCCCCCN1CCN(C(=O)C=Cc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C27H30Cl3N3O2/c28-23-9-4-21(5-10-23)7-12-26(34)31-14-2-1-3-15-32-16-18-33(19-17-32)27(35)13-8-22-6-11-24(29)25(30)20-22/h4-13,20H,1-3,14-19H2,(H,31,34)/b12-7+,13-8? |
| InChIKey | DSLNSSBBWLMIIQ-QLQROWNFSA-N |
| XLogP | 5.80 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.92 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|