C31H39Cl2N3O2 — CID 45481261
(E)-N-[3-[1-[5-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]pentyl]piperidin-4-yl]propyl]-3-phenylprop-2-enamide (PubChem CID 45481261) has the molecular formula C31H39Cl2N3O2 and a molecular weight of 556.58 g/mol. Its IUPAC name is (E)-N-[3-[1-[5-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]pentyl]piperidin-4-yl]propyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[3-[1-[5-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]pentyl]piperidin-4-yl]propyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 45481261 |
| Molecular Formula | C31H39Cl2N3O2 |
| Molecular Weight | 556.58 g/mol |
| Exact Mass | 555.24 |
| IUPAC Name | (E)-N-[3-[1-[5-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]pentyl]piperidin-4-yl]propyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)NCCCCCN1CCC(CCCNC(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C31H39Cl2N3O2/c32-28-14-11-27(24-29(28)33)13-16-31(38)34-19-5-2-6-21-36-22-17-26(18-23-36)10-7-20-35-30(37)15-12-25-8-3-1-4-9-25/h1,3-4,8-9,11-16,24,26H,2,5-7,10,17-23H2,(H,34,38)(H,35,37)/b15-12+,16-13+ |
| InChIKey | UYOYAWQYGOPBCL-WSGPNKEYSA-N |
| XLogP | 6.61 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.58 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|