C27H34Cl2FN3O3S — CID 45480771
(E)-3-(3,4-dichlorophenyl)-N-[5-[4-[2-[(4-fluorophenyl)sulfonylamino]ethyl]piperidin-1-yl]pentyl]prop-2-enamide (PubChem CID 45480771) has the molecular formula C27H34Cl2FN3O3S and a molecular weight of 570.56 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[2-[(4-fluorophenyl)sulfonylamino]ethyl]piperidin-1-yl]pentyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[2-[(4-fluorophenyl)sulfonylamino]ethyl]piperidin-1-yl]pentyl]prop-2-enamide |
|---|---|
| PubChem CID | 45480771 |
| Molecular Formula | C27H34Cl2FN3O3S |
| Molecular Weight | 570.56 g/mol |
| Exact Mass | 569.17 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[2-[(4-fluorophenyl)sulfonylamino]ethyl]piperidin-1-yl]pentyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)NCCCCCN1CCC(CCNS(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C27H34Cl2FN3O3S/c28-25-10-4-22(20-26(25)29)5-11-27(34)31-15-2-1-3-17-33-18-13-21(14-19-33)12-16-32-37(35,36)24-8-6-23(30)7-9-24/h4-11,20-21,32H,1-3,12-19H2,(H,31,34)/b11-5+ |
| InChIKey | CVHFRZGHFAJTMH-VZUCSPMQSA-N |
| XLogP | 5.51 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.56 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|