C32H41Cl2N3O2 — CID 45481472
N-[3-[1-[5-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]pentyl]piperidin-4-yl]propyl]-2-phenylcyclopropane-1-carboxamide (PubChem CID 45481472) has the molecular formula C32H41Cl2N3O2 and a molecular weight of 570.61 g/mol. Its IUPAC name is N-[3-[1-[5-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]pentyl]piperidin-4-yl]propyl]-2-phenylcyclopropane-1-carboxamide.
| Compound Name | N-[3-[1-[5-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]pentyl]piperidin-4-yl]propyl]-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 45481472 |
| Molecular Formula | C32H41Cl2N3O2 |
| Molecular Weight | 570.61 g/mol |
| Exact Mass | 569.26 |
| IUPAC Name | N-[3-[1-[5-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]pentyl]piperidin-4-yl]propyl]-2-phenylcyclopropane-1-carboxamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)NCCCCCN1CCC(CCCNC(=O)C2CC2c2ccccc2)CC1 |
| InChI | InChI=1S/C32H41Cl2N3O2/c33-29-13-11-25(22-30(29)34)12-14-31(38)35-17-5-2-6-19-37-20-15-24(16-21-37)8-7-18-36-32(39)28-23-27(28)26-9-3-1-4-10-26/h1,3-4,9-14,22,24,27-28H,2,5-8,15-21,23H2,(H,35,38)(H,36,39)/b14-12+ |
| InChIKey | RXONTSVTWRMLQQ-WYMLVPIESA-N |
| XLogP | 6.71 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.61 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|