C26H27Cl3F3N3O4 — CID 44525568
3-chloro-N-[3-[4-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]piperidin-1-yl]propyl]benzamide;2,2,2-trifluoroacetic acid (PubChem CID 44525568) has the molecular formula C26H27Cl3F3N3O4 and a molecular weight of 608.87 g/mol. Its IUPAC name is 3-chloro-N-[3-[4-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]piperidin-1-yl]propyl]benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-chloro-N-[3-[4-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]piperidin-1-yl]propyl]benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44525568 |
| Molecular Formula | C26H27Cl3F3N3O4 |
| Molecular Weight | 608.87 g/mol |
| Exact Mass | 607.10 |
| IUPAC Name | 3-chloro-N-[3-[4-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]piperidin-1-yl]propyl]benzamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)NC1CCN(CCCNC(=O)c2cccc(Cl)c2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H26Cl3N3O2.C2HF3O2/c25-19-4-1-3-18(16-19)24(32)28-11-2-12-30-13-9-20(10-14-30)29-23(31)8-6-17-5-7-21(26)22(27)15-17;3-2(4,5)1(6)7/h1,3-8,15-16,20H,2,9-14H2,(H,28,32)(H,29,31);(H,6,7)/b8-6+; |
| InChIKey | BPFFDDYEJLFOGY-WVLIHFOGSA-N |
| XLogP | 5.69 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.87 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|