C24H25Cl2F3N2O3 — CID 44526997
3-(3,4-dichlorophenyl)-N-[1-(2-phenylethyl)piperidin-4-yl]prop-2-enamide;2,2,2-trifluoroacetic acid (PubChem CID 44526997) has the molecular formula C24H25Cl2F3N2O3 and a molecular weight of 517.38 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N-[1-(2-phenylethyl)piperidin-4-yl]prop-2-enamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-(3,4-dichlorophenyl)-N-[1-(2-phenylethyl)piperidin-4-yl]prop-2-enamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44526997 |
| Molecular Formula | C24H25Cl2F3N2O3 |
| Molecular Weight | 517.38 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N-[1-(2-phenylethyl)piperidin-4-yl]prop-2-enamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(C=Cc1ccc(Cl)c(Cl)c1)NC1CCN(CCc2ccccc2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H24Cl2N2O.C2HF3O2/c23-20-8-6-18(16-21(20)24)7-9-22(27)25-19-11-14-26(15-12-19)13-10-17-4-2-1-3-5-17;3-2(4,5)1(6)7/h1-9,16,19H,10-15H2,(H,25,27);(H,6,7) |
| InChIKey | ZUDFZZGUVNYPOB-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.38 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|