C23H31ClN2O4 — CID 70426836
(E)-3-(3,4-dihydroxyphenyl)-N-[1-(3-phenylpropyl)piperidin-4-yl]prop-2-enamide;hydrate;hydrochloride (PubChem CID 70426836) has the molecular formula C23H31ClN2O4 and a molecular weight of 434.96 g/mol. Its IUPAC name is (E)-3-(3,4-dihydroxyphenyl)-N-[1-(3-phenylpropyl)piperidin-4-yl]prop-2-enamide;hydrate;hydrochloride.
| Compound Name | (E)-3-(3,4-dihydroxyphenyl)-N-[1-(3-phenylpropyl)piperidin-4-yl]prop-2-enamide;hydrate;hydrochloride |
|---|---|
| PubChem CID | 70426836 |
| Molecular Formula | C23H31ClN2O4 |
| Molecular Weight | 434.96 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | (E)-3-(3,4-dihydroxyphenyl)-N-[1-(3-phenylpropyl)piperidin-4-yl]prop-2-enamide;hydrate;hydrochloride |
| SMILES | Cl.O.O=C(/C=C/c1ccc(O)c(O)c1)NC1CCN(CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C23H28N2O3.ClH.H2O/c26-21-10-8-19(17-22(21)27)9-11-23(28)24-20-12-15-25(16-13-20)14-4-7-18-5-2-1-3-6-18;;/h1-3,5-6,8-11,17,20,26-27H,4,7,12-16H2,(H,24,28);1H;1H2/b11-9+;; |
| InChIKey | BIIBSZVBEOPGNL-OTBYXNOXSA-N |
| XLogP | 2.92 |
| TPSA | 104.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.96 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|