C17H18O3S — CID 90675396
4-[(E)-2-(3-phenylpropylsulfinyl)ethenyl]benzene-1,2-diol (PubChem CID 90675396) has the molecular formula C17H18O3S and a molecular weight of 302.40 g/mol. Its IUPAC name is 4-[(E)-2-(3-phenylpropylsulfinyl)ethenyl]benzene-1,2-diol.
| Compound Name | 4-[(E)-2-(3-phenylpropylsulfinyl)ethenyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 90675396 |
| Molecular Formula | C17H18O3S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 4-[(E)-2-(3-phenylpropylsulfinyl)ethenyl]benzene-1,2-diol |
| SMILES | O=S(/C=C/c1ccc(O)c(O)c1)CCCc1ccccc1 |
| InChI | InChI=1S/C17H18O3S/c18-16-9-8-15(13-17(16)19)10-12-21(20)11-4-7-14-5-2-1-3-6-14/h1-3,5-6,8-10,12-13,18-19H,4,7,11H2/b12-10+ |
| InChIKey | RSGRALUGUPVZEX-ZRDIBKRKSA-N |
| XLogP | 3.45 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|