C22H30O2 — CID 14057488
4-(10-phenyldecyl)benzene-1,2-diol (PubChem CID 14057488) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is 4-(10-phenyldecyl)benzene-1,2-diol.
| Compound Name | 4-(10-phenyldecyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 14057488 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 4-(10-phenyldecyl)benzene-1,2-diol |
| SMILES | Oc1ccc(CCCCCCCCCCc2ccccc2)cc1O |
| InChI | InChI=1S/C22H30O2/c23-21-17-16-20(18-22(21)24)15-9-6-4-2-1-3-5-8-12-19-13-10-7-11-14-19/h7,10-11,13-14,16-18,23-24H,1-6,8-9,12,15H2 |
| InChIKey | CYQZXLDTNYXYIB-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|