C21H26O4 — CID 137376047
2-[(3,4-dihydroxyphenyl)methyl]-8-phenyloctanoic acid (PubChem CID 137376047) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is 2-[(3,4-dihydroxyphenyl)methyl]-8-phenyloctanoic acid.
| Compound Name | 2-[(3,4-dihydroxyphenyl)methyl]-8-phenyloctanoic acid |
|---|---|
| PubChem CID | 137376047 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 2-[(3,4-dihydroxyphenyl)methyl]-8-phenyloctanoic acid |
| SMILES | O=C(O)C(CCCCCCc1ccccc1)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C21H26O4/c22-19-13-12-17(15-20(19)23)14-18(21(24)25)11-7-2-1-4-8-16-9-5-3-6-10-16/h3,5-6,9-10,12-13,15,18,22-23H,1-2,4,7-8,11,14H2,(H,24,25) |
| InChIKey | AMZJFGWERKGDIF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|