C24H30O8 — CID 122512055
2,7-bis[(4-hydroxy-3-methoxyphenyl)methyl]octanedioic acid (PubChem CID 122512055) has the molecular formula C24H30O8 and a molecular weight of 446.50 g/mol. Its IUPAC name is 2,7-bis[(4-hydroxy-3-methoxyphenyl)methyl]octanedioic acid.
| Compound Name | 2,7-bis[(4-hydroxy-3-methoxyphenyl)methyl]octanedioic acid |
|---|---|
| PubChem CID | 122512055 |
| Molecular Formula | C24H30O8 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 2,7-bis[(4-hydroxy-3-methoxyphenyl)methyl]octanedioic acid |
| SMILES | COc1cc(CC(CCCCC(Cc2ccc(O)c(OC)c2)C(=O)O)C(=O)O)ccc1O |
| InChI | InChI=1S/C24H30O8/c1-31-21-13-15(7-9-19(21)25)11-17(23(27)28)5-3-4-6-18(24(29)30)12-16-8-10-20(26)22(14-16)32-2/h7-10,13-14,17-18,25-26H,3-6,11-12H2,1-2H3,(H,27,28)(H,29,30) |
| InChIKey | DXYLPDVYXADYPW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|