C17H18O5 — CID 83955199
3-(4-hydroxy-3-methoxyphenyl)-2-(2-methoxyphenyl)propanoic acid (PubChem CID 83955199) has the molecular formula C17H18O5 and a molecular weight of 302.33 g/mol. Its IUPAC name is 3-(4-hydroxy-3-methoxyphenyl)-2-(2-methoxyphenyl)propanoic acid.
| Compound Name | 3-(4-hydroxy-3-methoxyphenyl)-2-(2-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 83955199 |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 3-(4-hydroxy-3-methoxyphenyl)-2-(2-methoxyphenyl)propanoic acid |
| SMILES | COc1cc(CC(C(=O)O)c2ccccc2OC)ccc1O |
| InChI | InChI=1S/C17H18O5/c1-21-15-6-4-3-5-12(15)13(17(19)20)9-11-7-8-14(18)16(10-11)22-2/h3-8,10,13,18H,9H2,1-2H3,(H,19,20) |
| InChIKey | CFDFGBGTFURAJU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |