C21H20O4 — CID 83954183
3-(3-ethoxy-4-hydroxyphenyl)-2-naphthalen-1-ylpropanoic acid (PubChem CID 83954183) has the molecular formula C21H20O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is 3-(3-ethoxy-4-hydroxyphenyl)-2-naphthalen-1-ylpropanoic acid.
| Compound Name | 3-(3-ethoxy-4-hydroxyphenyl)-2-naphthalen-1-ylpropanoic acid |
|---|---|
| PubChem CID | 83954183 |
| Molecular Formula | C21H20O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 3-(3-ethoxy-4-hydroxyphenyl)-2-naphthalen-1-ylpropanoic acid |
| SMILES | CCOc1cc(CC(C(=O)O)c2cccc3ccccc23)ccc1O |
| InChI | InChI=1S/C21H20O4/c1-2-25-20-13-14(10-11-19(20)22)12-18(21(23)24)17-9-5-7-15-6-3-4-8-16(15)17/h3-11,13,18,22H,2,12H2,1H3,(H,23,24) |
| InChIKey | NNSNVHVMJMRCAB-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |