C20H24O5 — CID 83954170
3-(3-ethoxy-4-hydroxyphenyl)-2-(4-ethoxy-3-methylphenyl)propanoic acid (PubChem CID 83954170) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is 3-(3-ethoxy-4-hydroxyphenyl)-2-(4-ethoxy-3-methylphenyl)propanoic acid.
| Compound Name | 3-(3-ethoxy-4-hydroxyphenyl)-2-(4-ethoxy-3-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 83954170 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 3-(3-ethoxy-4-hydroxyphenyl)-2-(4-ethoxy-3-methylphenyl)propanoic acid |
| SMILES | CCOc1ccc(C(Cc2ccc(O)c(OCC)c2)C(=O)O)cc1C |
| InChI | InChI=1S/C20H24O5/c1-4-24-18-9-7-15(10-13(18)3)16(20(22)23)11-14-6-8-17(21)19(12-14)25-5-2/h6-10,12,16,21H,4-5,11H2,1-3H3,(H,22,23) |
| InChIKey | IPXJRAVGORCYKA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |