C20H15NO2 — CID 82140892
3-(3-cyanophenyl)-2-naphthalen-1-ylpropanoic acid (PubChem CID 82140892) has the molecular formula C20H15NO2 and a molecular weight of 301.35 g/mol. Its IUPAC name is 3-(3-cyanophenyl)-2-naphthalen-1-ylpropanoic acid.
| Compound Name | 3-(3-cyanophenyl)-2-naphthalen-1-ylpropanoic acid |
|---|---|
| PubChem CID | 82140892 |
| Molecular Formula | C20H15NO2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 3-(3-cyanophenyl)-2-naphthalen-1-ylpropanoic acid |
| SMILES | N#Cc1cccc(CC(C(=O)O)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C20H15NO2/c21-13-15-6-3-5-14(11-15)12-19(20(22)23)18-10-4-8-16-7-1-2-9-17(16)18/h1-11,19H,12H2,(H,22,23) |
| InChIKey | TZCFHWHIBCCSMD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |