C20H21NO3 — CID 82140909
3-(3-cyanophenyl)-2-(2-methoxy-5-propan-2-ylphenyl)propanoic acid (PubChem CID 82140909) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is 3-(3-cyanophenyl)-2-(2-methoxy-5-propan-2-ylphenyl)propanoic acid.
| Compound Name | 3-(3-cyanophenyl)-2-(2-methoxy-5-propan-2-ylphenyl)propanoic acid |
|---|---|
| PubChem CID | 82140909 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 3-(3-cyanophenyl)-2-(2-methoxy-5-propan-2-ylphenyl)propanoic acid |
| SMILES | COc1ccc(C(C)C)cc1C(Cc1cccc(C#N)c1)C(=O)O |
| InChI | InChI=1S/C20H21NO3/c1-13(2)16-7-8-19(24-3)17(11-16)18(20(22)23)10-14-5-4-6-15(9-14)12-21/h4-9,11,13,18H,10H2,1-3H3,(H,22,23) |
| InChIKey | DKEKQLWDNGVYGZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |