C17H17FO3 — CID 82140408
3-(3-fluorophenyl)-2-(2-methoxy-5-methylphenyl)propanoic acid (PubChem CID 82140408) has the molecular formula C17H17FO3 and a molecular weight of 288.32 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-2-(2-methoxy-5-methylphenyl)propanoic acid.
| Compound Name | 3-(3-fluorophenyl)-2-(2-methoxy-5-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 82140408 |
| Molecular Formula | C17H17FO3 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 3-(3-fluorophenyl)-2-(2-methoxy-5-methylphenyl)propanoic acid |
| SMILES | COc1ccc(C)cc1C(Cc1cccc(F)c1)C(=O)O |
| InChI | InChI=1S/C17H17FO3/c1-11-6-7-16(21-2)14(8-11)15(17(19)20)10-12-4-3-5-13(18)9-12/h3-9,15H,10H2,1-2H3,(H,19,20) |
| InChIKey | QNHKHSPEPLYPOA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |