C18H20BrFO — CID 66042915
2-[2-(bromomethyl)-3-(3-fluorophenyl)propyl]-1-methoxy-4-methylbenzene (PubChem CID 66042915) has the molecular formula C18H20BrFO and a molecular weight of 351.26 g/mol. Its IUPAC name is 2-[2-(bromomethyl)-3-(3-fluorophenyl)propyl]-1-methoxy-4-methylbenzene.
| Compound Name | 2-[2-(bromomethyl)-3-(3-fluorophenyl)propyl]-1-methoxy-4-methylbenzene |
|---|---|
| PubChem CID | 66042915 |
| Molecular Formula | C18H20BrFO |
| Molecular Weight | 351.26 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 2-[2-(bromomethyl)-3-(3-fluorophenyl)propyl]-1-methoxy-4-methylbenzene |
| SMILES | COc1ccc(C)cc1CC(CBr)Cc1cccc(F)c1 |
| InChI | InChI=1S/C18H20BrFO/c1-13-6-7-18(21-2)16(8-13)10-15(12-19)9-14-4-3-5-17(20)11-14/h3-8,11,15H,9-10,12H2,1-2H3 |
| InChIKey | HEOFSAHTNMCRPB-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.26 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|