C17H18BrF — CID 66041066
1-[2-(bromomethyl)-3-(3-fluorophenyl)propyl]-4-methylbenzene (PubChem CID 66041066) has the molecular formula C17H18BrF and a molecular weight of 321.23 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-3-(3-fluorophenyl)propyl]-4-methylbenzene.
| Compound Name | 1-[2-(bromomethyl)-3-(3-fluorophenyl)propyl]-4-methylbenzene |
|---|---|
| PubChem CID | 66041066 |
| Molecular Formula | C17H18BrF |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 1-[2-(bromomethyl)-3-(3-fluorophenyl)propyl]-4-methylbenzene |
| SMILES | Cc1ccc(CC(CBr)Cc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C17H18BrF/c1-13-5-7-14(8-6-13)9-16(12-18)10-15-3-2-4-17(19)11-15/h2-8,11,16H,9-10,12H2,1H3 |
| InChIKey | WBYJSSFJHONTOO-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|