C17H17BrCl2 — CID 66040669
2-[2-(bromomethyl)-3-(4-methylphenyl)propyl]-1,3-dichlorobenzene (PubChem CID 66040669) has the molecular formula C17H17BrCl2 and a molecular weight of 372.13 g/mol. Its IUPAC name is 2-[2-(bromomethyl)-3-(4-methylphenyl)propyl]-1,3-dichlorobenzene.
| Compound Name | 2-[2-(bromomethyl)-3-(4-methylphenyl)propyl]-1,3-dichlorobenzene |
|---|---|
| PubChem CID | 66040669 |
| Molecular Formula | C17H17BrCl2 |
| Molecular Weight | 372.13 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | 2-[2-(bromomethyl)-3-(4-methylphenyl)propyl]-1,3-dichlorobenzene |
| SMILES | Cc1ccc(CC(CBr)Cc2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C17H17BrCl2/c1-12-5-7-13(8-6-12)9-14(11-18)10-15-16(19)3-2-4-17(15)20/h2-8,14H,9-11H2,1H3 |
| InChIKey | MMAHWSDXHPJXAE-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.13 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|