C19H23Br — CID 66042111
1-[2-(bromomethyl)-3-(3-methylphenyl)propyl]-3,5-dimethylbenzene (PubChem CID 66042111) has the molecular formula C19H23Br and a molecular weight of 331.30 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-3-(3-methylphenyl)propyl]-3,5-dimethylbenzene.
| Compound Name | 1-[2-(bromomethyl)-3-(3-methylphenyl)propyl]-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 66042111 |
| Molecular Formula | C19H23Br |
| Molecular Weight | 331.30 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 1-[2-(bromomethyl)-3-(3-methylphenyl)propyl]-3,5-dimethylbenzene |
| SMILES | Cc1cccc(CC(CBr)Cc2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C19H23Br/c1-14-5-4-6-17(8-14)11-19(13-20)12-18-9-15(2)7-16(3)10-18/h4-10,19H,11-13H2,1-3H3 |
| InChIKey | BQVBMMYMWSBLTM-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.30 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|