C14H21BrO2S — CID 66042304
1-[2-(bromomethyl)-4-ethylsulfonylbutyl]-3-methylbenzene (PubChem CID 66042304) has the molecular formula C14H21BrO2S and a molecular weight of 333.29 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-4-ethylsulfonylbutyl]-3-methylbenzene.
| Compound Name | 1-[2-(bromomethyl)-4-ethylsulfonylbutyl]-3-methylbenzene |
|---|---|
| PubChem CID | 66042304 |
| Molecular Formula | C14H21BrO2S |
| Molecular Weight | 333.29 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 1-[2-(bromomethyl)-4-ethylsulfonylbutyl]-3-methylbenzene |
| SMILES | CCS(=O)(=O)CCC(CBr)Cc1cccc(C)c1 |
| InChI | InChI=1S/C14H21BrO2S/c1-3-18(16,17)8-7-14(11-15)10-13-6-4-5-12(2)9-13/h4-6,9,14H,3,7-8,10-11H2,1-2H3 |
| InChIKey | FWBJVSBRLDFFPY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|